About 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine
7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine (PubChem CID 89347927) has the molecular formula C20H10Cl3F3N4
and a molecular weight of 469.68 g/mol. Its IUPAC name is 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine |
| PubChem CID | 89347927 |
| Molecular Formula | C20H10Cl3F3N4 |
| Molecular Weight | 469.68 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine |
| SMILES | FC(F)(F)c1ccc(-c2nc(Nc3ccc(Cl)c(Cl)c3)c3ccc(Cl)cc3n2)cn1 |
| InChI | InChI=1S/C20H10Cl3F3N4/c21-11-2-4-13-16(7-11)29-18(10-1-6-17(27-9-10)20(24,25)26)30-19(13)28-12-3-5-14(22)15(23)8-12/h1-9H,(H,28,29,30) |
| InChIKey | KIQNDRXQCSWZFP-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.68 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine?
The IUPAC name of 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine (CID 89347927) is 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine.
What is the SMILES notation for 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine?
The canonical SMILES for 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine is FC(F)(F)c1ccc(-c2nc(Nc3ccc(Cl)c(Cl)c3)c3ccc(Cl)cc3n2)cn1.
What is the InChIKey of 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine?
The InChIKey is KIQNDRXQCSWZFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10Cl3F3N4/c21-11-2-4-13-16(7-11)29-18(10-1-6-17(27-9-10)20(24,25)26)30-19(13)28-12-3-5-14(22)15(23)8-12/h1-9H,(H,28,29,30).
What are the key properties of 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine?
7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine has a molecular weight of 469.68 g/mol, XLogP of 7.41, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-(3,4-dichlorophenyl)-2-[6-(trifluoromethyl)-3-pyridinyl]quinazolin-4-amine is sourced from PubChem (CID 89347927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).