About 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine
4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine (PubChem CID 89348061) has the molecular formula C23H15F2N5OS
and a molecular weight of 447.47 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine |
| PubChem CID | 89348061 |
| Molecular Formula | C23H15F2N5OS |
| Molecular Weight | 447.47 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine |
| SMILES | COc1ccc2nc(-c3cccnc3)nc(Nc3nc(-c4cc(F)cc(F)c4)cs3)c2c1 |
| InChI | InChI=1S/C23H15F2N5OS/c1-31-17-4-5-19-18(10-17)22(29-21(27-19)13-3-2-6-26-11-13)30-23-28-20(12-32-23)14-7-15(24)9-16(25)8-14/h2-12H,1H3,(H,27,28,29,30) |
| InChIKey | QGRLMTOMPKBFDD-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.47 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine (CID 89348061) is 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine is COc1ccc2nc(-c3cccnc3)nc(Nc3nc(-c4cc(F)cc(F)c4)cs3)c2c1.
What is the InChIKey of 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine?
The InChIKey is QGRLMTOMPKBFDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15F2N5OS/c1-31-17-4-5-19-18(10-17)22(29-21(27-19)13-3-2-6-26-11-13)30-23-28-20(12-32-23)14-7-15(24)9-16(25)8-14/h2-12H,1H3,(H,27,28,29,30).
What are the key properties of 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine?
4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine has a molecular weight of 447.47 g/mol, XLogP of 5.85, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-difluorophenyl)-N-(6-methoxy-2-pyridin-3-ylquinazolin-4-yl)-1,3-thiazol-2-amine is sourced from PubChem (CID 89348061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).