C27H31N5O3 — CID 89348557
N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N,1'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide (PubChem CID 89348557) has the molecular formula C27H31N5O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N,1'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide.
| Compound Name | N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N,1'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
|---|---|
| PubChem CID | 89348557 |
| Molecular Formula | C27H31N5O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | N-[4-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-N,1'-dimethylspiro[2,3,4,9-tetrahydropyrido[3,4-b]indole-1,4'-piperidine]-3-carboxamide |
| SMILES | CN1CCC2(CC1)NC(C(=O)N(C)c1ccc(/C=C/C(=O)NO)cc1)Cc1c2[nH]c2ccccc12 |
| InChI | InChI=1S/C27H31N5O3/c1-31-15-13-27(14-16-31)25-21(20-5-3-4-6-22(20)28-25)17-23(29-27)26(34)32(2)19-10-7-18(8-11-19)9-12-24(33)30-35/h3-12,23,28-29,35H,13-17H2,1-2H3,(H,30,33)/b12-9+ |
| InChIKey | RAIAPCSFAPRVNJ-FMIVXFBMSA-N |
| XLogP | 2.78 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|