C12H14BrN3O2S — CID 89351154
S-[[3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl] carbamothioate;hydrobromide (PubChem CID 89351154) has the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. Its IUPAC name is S-[[3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl] carbamothioate;hydrobromide.
| Compound Name | S-[[3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl] carbamothioate;hydrobromide |
|---|---|
| PubChem CID | 89351154 |
| Molecular Formula | C12H14BrN3O2S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | S-[[3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]methyl] carbamothioate;hydrobromide |
| SMILES | Br.CCc1nc(-c2cccc(CSC(N)=O)c2)no1 |
| InChI | InChI=1S/C12H13N3O2S.BrH/c1-2-10-14-11(15-17-10)9-5-3-4-8(6-9)7-18-12(13)16;/h3-6H,2,7H2,1H3,(H2,13,16);1H |
| InChIKey | GSRAITQBSAYCRJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|