C15H19N3O5 — CID 89354647
6-formamido-N-[2-(2-nitrophenyl)-2-oxoethyl]hexanamide (PubChem CID 89354647) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is 6-formamido-N-[2-(2-nitrophenyl)-2-oxoethyl]hexanamide.
| Compound Name | 6-formamido-N-[2-(2-nitrophenyl)-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 89354647 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 6-formamido-N-[2-(2-nitrophenyl)-2-oxoethyl]hexanamide |
| SMILES | O=CNCCCCCC(=O)NCC(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H19N3O5/c19-11-16-9-5-1-2-8-15(21)17-10-14(20)12-6-3-4-7-13(12)18(22)23/h3-4,6-7,11H,1-2,5,8-10H2,(H,16,19)(H,17,21) |
| InChIKey | MXEPYBKKRUILMN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|