C12H22N2O — CID 89355235
(1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine (PubChem CID 89355235) has the molecular formula C12H22N2O and a molecular weight of 210.32 g/mol. Its IUPAC name is (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 89355235 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine |
| SMILES | CC(/C=C\N)=C/COCC1CCCN1C |
| InChI | InChI=1S/C12H22N2O/c1-11(5-7-13)6-9-15-10-12-4-3-8-14(12)2/h5-7,12H,3-4,8-10,13H2,1-2H3/b7-5-,11-6- |
| InChIKey | VBDRSXLGEIPMGY-JMPJYAQRSA-N |
| XLogP | 1.52 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|