About (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine
(1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine (PubChem CID 89355235) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine |
| PubChem CID | 89355235 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine |
| SMILES | CC(/C=C\N)=C/COCC1CCCN1C |
| InChI | InChI=1S/C12H22N2O/c1-11(5-7-13)6-9-15-10-12-4-3-8-14(12)2/h5-7,12H,3-4,8-10,13H2,1-2H3/b7-5-,11-6- |
| InChIKey | VBDRSXLGEIPMGY-JMPJYAQRSA-N |
| XLogP | 1.52 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine?
The IUPAC name of (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine (CID 89355235) is (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine.
What is the SMILES notation for (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine?
The canonical SMILES for (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine is CC(/C=C\N)=C/COCC1CCCN1C.
What is the InChIKey of (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine?
The InChIKey is VBDRSXLGEIPMGY-JMPJYAQRSA-N. The full InChI is InChI=1S/C12H22N2O/c1-11(5-7-13)6-9-15-10-12-4-3-8-14(12)2/h5-7,12H,3-4,8-10,13H2,1-2H3/b7-5-,11-6-.
What are the key properties of (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine?
(1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine has a molecular weight of 210.32 g/mol, XLogP of 1.52, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3Z)-3-methyl-5-[(1-methylpyrrolidin-2-yl)methoxy]penta-1,3-dien-1-amine is sourced from PubChem (CID 89355235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).