C13H11N3O2S2 — CID 8935687
(2R)-2-(4-methyl-1,3-thiazol-2-yl)-4-(1-oxidopyridin-1-ium-2-yl)sulfanyl-3-oxobutanenitrile (PubChem CID 8935687) has the molecular formula C13H11N3O2S2 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2R)-2-(4-methyl-1,3-thiazol-2-yl)-4-(1-oxidopyridin-1-ium-2-yl)sulfanyl-3-oxobutanenitrile.
| Compound Name | (2R)-2-(4-methyl-1,3-thiazol-2-yl)-4-(1-oxidopyridin-1-ium-2-yl)sulfanyl-3-oxobutanenitrile |
|---|---|
| PubChem CID | 8935687 |
| Molecular Formula | C13H11N3O2S2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | (2R)-2-(4-methyl-1,3-thiazol-2-yl)-4-(1-oxidopyridin-1-ium-2-yl)sulfanyl-3-oxobutanenitrile |
| SMILES | Cc1csc([C@H](C#N)C(=O)CSc2cccc[n+]2[O-])n1 |
| InChI | InChI=1S/C13H11N3O2S2/c1-9-7-20-13(15-9)10(6-14)11(17)8-19-12-4-2-3-5-16(12)18/h2-5,7,10H,8H2,1H3/t10-/m1/s1 |
| InChIKey | MDTPNTQDXBTZJY-SNVBAGLBSA-N |
| XLogP | 2.05 |
| TPSA | 80.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|