C14H11N3O4S — CID 8954942
[(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 8954942) has the molecular formula C14H11N3O4S and a molecular weight of 317.33 g/mol. Its IUPAC name is [(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 8954942 |
| Molecular Formula | C14H11N3O4S |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | [(3R)-3-cyano-3-(4-methyl-1,3-thiazol-2-yl)-2-oxopropyl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | Cc1csc([C@H](C#N)C(=O)COC(=O)c2cccc[n+]2[O-])n1 |
| InChI | InChI=1S/C14H11N3O4S/c1-9-8-22-13(16-9)10(6-15)12(18)7-21-14(19)11-4-2-3-5-17(11)20/h2-5,8,10H,7H2,1H3/t10-/m1/s1 |
| InChIKey | ISYXVNZKZLDUSW-SNVBAGLBSA-N |
| XLogP | 1.12 |
| TPSA | 106.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|