C30H36FN5O4 — CID 89358264
(3R,5R)-7-[5-[(3Z)-4-[[amino(anilino)methylidene]amino]buta-1,3-dien-2-yl]-4-(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoic acid (PubChem CID 89358264) has the molecular formula C30H36FN5O4 and a molecular weight of 549.65 g/mol. Its IUPAC name is (3R,5R)-7-[5-[(3Z)-4-[[amino(anilino)methylidene]amino]buta-1,3-dien-2-yl]-4-(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoic acid.
| Compound Name | (3R,5R)-7-[5-[(3Z)-4-[[amino(anilino)methylidene]amino]buta-1,3-dien-2-yl]-4-(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoic acid |
|---|---|
| PubChem CID | 89358264 |
| Molecular Formula | C30H36FN5O4 |
| Molecular Weight | 549.65 g/mol |
| Exact Mass | 549.28 |
| IUPAC Name | (3R,5R)-7-[5-[(3Z)-4-[[amino(anilino)methylidene]amino]buta-1,3-dien-2-yl]-4-(4-fluorophenyl)-2-propan-2-ylimidazol-1-yl]-3,5-dihydroxyheptanoic acid |
| SMILES | C=C(/C=C\N=C(/N)Nc1ccccc1)c1c(-c2ccc(F)cc2)nc(C(C)C)n1CC[C@@H](O)C[C@@H](O)CC(=O)O |
| InChI | InChI=1S/C30H36FN5O4/c1-19(2)29-35-27(21-9-11-22(31)12-10-21)28(36(29)16-14-24(37)17-25(38)18-26(39)40)20(3)13-15-33-30(32)34-23-7-5-4-6-8-23/h4-13,15,19,24-25,37-38H,3,14,16-18H2,1-2H3,(H,39,40)(H3,32,33,34)/b15-13-/t24-,25-/m1/s1 |
| InChIKey | HPKWRQSFUNFSJF-VOQLSNMDSA-N |
| XLogP | 4.74 |
| TPSA | 145.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|