C21H19FN2O4S — CID 89358711
3-[(2Z)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-propoxyiminoethoxy]benzoic acid (PubChem CID 89358711) has the molecular formula C21H19FN2O4S and a molecular weight of 414.46 g/mol. Its IUPAC name is 3-[(2Z)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-propoxyiminoethoxy]benzoic acid.
| Compound Name | 3-[(2Z)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-propoxyiminoethoxy]benzoic acid |
|---|---|
| PubChem CID | 89358711 |
| Molecular Formula | C21H19FN2O4S |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 3-[(2Z)-2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]-2-propoxyiminoethoxy]benzoic acid |
| SMILES | CCCO/N=C(\COc1cccc(C(=O)O)c1)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C21H19FN2O4S/c1-2-10-28-24-18(12-27-17-5-3-4-15(11-17)21(25)26)19-13-29-20(23-19)14-6-8-16(22)9-7-14/h3-9,11,13H,2,10,12H2,1H3,(H,25,26)/b24-18+ |
| InChIKey | ISXPNQJGOUAHKH-HKOYGPOVSA-N |
| XLogP | 4.86 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|