C22H21FN2O6 — CID 173165164
3-[2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]-5-(hydroxymethyl)benzoic acid (PubChem CID 173165164) has the molecular formula C22H21FN2O6 and a molecular weight of 428.42 g/mol. Its IUPAC name is 3-[2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]-5-(hydroxymethyl)benzoic acid.
| Compound Name | 3-[2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]-5-(hydroxymethyl)benzoic acid |
|---|---|
| PubChem CID | 173165164 |
| Molecular Formula | C22H21FN2O6 |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 3-[2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]-5-(hydroxymethyl)benzoic acid |
| SMILES | CCCON=C(COc1cc(CO)cc(C(=O)O)c1)c1cc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C22H21FN2O6/c1-2-7-30-24-20(13-29-18-9-14(12-26)8-16(10-18)22(27)28)21-11-19(25-31-21)15-3-5-17(23)6-4-15/h3-6,8-11,26H,2,7,12-13H2,1H3,(H,27,28) |
| InChIKey | PIILWGOTMWSOGL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 114.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|