C21H18FN3O3 — CID 142695089
3-[(2E)-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]benzonitrile (PubChem CID 142695089) has the molecular formula C21H18FN3O3 and a molecular weight of 379.39 g/mol. Its IUPAC name is 3-[(2E)-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]benzonitrile.
| Compound Name | 3-[(2E)-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]benzonitrile |
|---|---|
| PubChem CID | 142695089 |
| Molecular Formula | C21H18FN3O3 |
| Molecular Weight | 379.39 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-[(2E)-2-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]-2-propoxyiminoethoxy]benzonitrile |
| SMILES | CCCO/N=C(\COc1cccc(C#N)c1)c1cc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C21H18FN3O3/c1-2-10-27-24-20(14-26-18-5-3-4-15(11-18)13-23)21-12-19(25-28-21)16-6-8-17(22)9-7-16/h3-9,11-12H,2,10,14H2,1H3/b24-20+ |
| InChIKey | JBKWQPSOJYLPTF-HIXSDJFHSA-N |
| XLogP | 4.56 |
| TPSA | 80.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|