C15H17BrN2O2 — CID 142688191
(Z)-2-bromo-N-butoxy-1-(3-phenyl-1,2-oxazol-5-yl)ethanimine (PubChem CID 142688191) has the molecular formula C15H17BrN2O2 and a molecular weight of 337.22 g/mol. Its IUPAC name is (Z)-2-bromo-N-butoxy-1-(3-phenyl-1,2-oxazol-5-yl)ethanimine.
| Compound Name | (Z)-2-bromo-N-butoxy-1-(3-phenyl-1,2-oxazol-5-yl)ethanimine |
|---|---|
| PubChem CID | 142688191 |
| Molecular Formula | C15H17BrN2O2 |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | (Z)-2-bromo-N-butoxy-1-(3-phenyl-1,2-oxazol-5-yl)ethanimine |
| SMILES | CCCCO/N=C(\CBr)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C15H17BrN2O2/c1-2-3-9-19-17-14(11-16)15-10-13(18-20-15)12-7-5-4-6-8-12/h4-8,10H,2-3,9,11H2,1H3/b17-14+ |
| InChIKey | HRMQVEROKLVAEY-SAPNQHFASA-N |
| XLogP | 4.26 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|