C26H30O5 — CID 89360659
5-[3-[4-(2-hydroxy-3-methylbut-3-enoxy)-3-methylphenyl]pentan-3-yl]-1-benzofuran-2-carboxylic acid (PubChem CID 89360659) has the molecular formula C26H30O5 and a molecular weight of 422.52 g/mol. Its IUPAC name is 5-[3-[4-(2-hydroxy-3-methylbut-3-enoxy)-3-methylphenyl]pentan-3-yl]-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[3-[4-(2-hydroxy-3-methylbut-3-enoxy)-3-methylphenyl]pentan-3-yl]-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 89360659 |
| Molecular Formula | C26H30O5 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 5-[3-[4-(2-hydroxy-3-methylbut-3-enoxy)-3-methylphenyl]pentan-3-yl]-1-benzofuran-2-carboxylic acid |
| SMILES | C=C(C)C(O)COc1ccc(C(CC)(CC)c2ccc3oc(C(=O)O)cc3c2)cc1C |
| InChI | InChI=1S/C26H30O5/c1-6-26(7-2,20-9-11-23-18(13-20)14-24(31-23)25(28)29)19-8-10-22(17(5)12-19)30-15-21(27)16(3)4/h8-14,21,27H,3,6-7,15H2,1-2,4-5H3,(H,28,29) |
| InChIKey | ULEOCCMOXOSDQJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|