C19H24O5 — CID 89362180
2-[2-[(E)-2-ethenylbut-2-enoyl]oxypropoxy]propyl benzoate (PubChem CID 89362180) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[2-[(E)-2-ethenylbut-2-enoyl]oxypropoxy]propyl benzoate.
| Compound Name | 2-[2-[(E)-2-ethenylbut-2-enoyl]oxypropoxy]propyl benzoate |
|---|---|
| PubChem CID | 89362180 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[2-[(E)-2-ethenylbut-2-enoyl]oxypropoxy]propyl benzoate |
| SMILES | C=C/C(=C\C)C(=O)OC(C)COC(C)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24O5/c1-5-16(6-2)19(21)24-15(4)13-22-14(3)12-23-18(20)17-10-8-7-9-11-17/h5-11,14-15H,1,12-13H2,2-4H3/b16-6+ |
| InChIKey | ZDBNGZZXWJUCBU-OMCISZLKSA-N |
| XLogP | 3.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|