C15H15F3N2O4 — CID 8936389
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(2-methylphenyl)prop-2-enoate (PubChem CID 8936389) has the molecular formula C15H15F3N2O4 and a molecular weight of 344.29 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(2-methylphenyl)prop-2-enoate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8936389 |
| Molecular Formula | C15H15F3N2O4 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (E)-3-(2-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccccc1/C=C/C(=O)OCC(=O)NC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O4/c1-10-4-2-3-5-11(10)6-7-13(22)24-8-12(21)20-14(23)19-9-15(16,17)18/h2-7H,8-9H2,1H3,(H2,19,20,21,23)/b7-6+ |
| InChIKey | OAAAMIZGSNDUSR-VOTSOKGWSA-N |
| XLogP | 1.94 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|