C17H19N3O3 — CID 89369426
3-(C,N-dimethylcarbonimidoyl)-2-(2-methoxyanilino)-6-methylpyridine-4-carboxylic acid (PubChem CID 89369426) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 3-(C,N-dimethylcarbonimidoyl)-2-(2-methoxyanilino)-6-methylpyridine-4-carboxylic acid.
| Compound Name | 3-(C,N-dimethylcarbonimidoyl)-2-(2-methoxyanilino)-6-methylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 89369426 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-(C,N-dimethylcarbonimidoyl)-2-(2-methoxyanilino)-6-methylpyridine-4-carboxylic acid |
| SMILES | C/N=C(\C)c1c(C(=O)O)cc(C)nc1Nc1ccccc1OC |
| InChI | InChI=1S/C17H19N3O3/c1-10-9-12(17(21)22)15(11(2)18-3)16(19-10)20-13-7-5-6-8-14(13)23-4/h5-9H,1-4H3,(H,19,20)(H,21,22)/b18-11+ |
| InChIKey | RTNGALMKZACPON-WOJGMQOQSA-N |
| XLogP | 3.28 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|