C17H14N2O4 — CID 70545123
2-(2-hydroxyanilino)-8-methoxyquinoline-3-carboxylic acid (PubChem CID 70545123) has the molecular formula C17H14N2O4 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-(2-hydroxyanilino)-8-methoxyquinoline-3-carboxylic acid.
| Compound Name | 2-(2-hydroxyanilino)-8-methoxyquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 70545123 |
| Molecular Formula | C17H14N2O4 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 2-(2-hydroxyanilino)-8-methoxyquinoline-3-carboxylic acid |
| SMILES | COc1cccc2cc(C(=O)O)c(Nc3ccccc3O)nc12 |
| InChI | InChI=1S/C17H14N2O4/c1-23-14-8-4-5-10-9-11(17(21)22)16(19-15(10)14)18-12-6-2-3-7-13(12)20/h2-9,20H,1H3,(H,18,19)(H,21,22) |
| InChIKey | JXURNEDNXDWZIO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_acid_J(1)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|