C12H11N3O4 — CID 136965891
3-(2-hydroxyanilino)-6-methoxypyridazine-4-carboxylic acid (PubChem CID 136965891) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is 3-(2-hydroxyanilino)-6-methoxypyridazine-4-carboxylic acid.
| Compound Name | 3-(2-hydroxyanilino)-6-methoxypyridazine-4-carboxylic acid |
|---|---|
| PubChem CID | 136965891 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 3-(2-hydroxyanilino)-6-methoxypyridazine-4-carboxylic acid |
| SMILES | COc1cc(C(=O)O)c(Nc2ccccc2O)nn1 |
| InChI | InChI=1S/C12H11N3O4/c1-19-10-6-7(12(17)18)11(15-14-10)13-8-4-2-3-5-9(8)16/h2-6,16H,1H3,(H,13,15)(H,17,18) |
| InChIKey | QHZLNZKQHMHGTO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|