C18H15N5O6 — CID 57474633
2-(2-hydroxyanilino)-6-(2-methoxyanilino)-5-nitropyrimidine-4-carboxylic acid (PubChem CID 57474633) has the molecular formula C18H15N5O6 and a molecular weight of 397.35 g/mol. Its IUPAC name is 2-(2-hydroxyanilino)-6-(2-methoxyanilino)-5-nitropyrimidine-4-carboxylic acid.
| Compound Name | 2-(2-hydroxyanilino)-6-(2-methoxyanilino)-5-nitropyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 57474633 |
| Molecular Formula | C18H15N5O6 |
| Molecular Weight | 397.35 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-(2-hydroxyanilino)-6-(2-methoxyanilino)-5-nitropyrimidine-4-carboxylic acid |
| SMILES | COc1ccccc1Nc1nc(Nc2ccccc2O)nc(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H15N5O6/c1-29-13-9-5-3-7-11(13)19-16-15(23(27)28)14(17(25)26)21-18(22-16)20-10-6-2-4-8-12(10)24/h2-9,24H,1H3,(H,25,26)(H2,19,20,21,22) |
| InChIKey | JUBVFLNXFWNUIL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 159.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|