C23H30N6O7 — CID 86627709
ethyl 6-(2-methoxyanilino)-2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-5-nitropyrimidine-4-carboxylate (PubChem CID 86627709) has the molecular formula C23H30N6O7 and a molecular weight of 502.53 g/mol. Its IUPAC name is ethyl 6-(2-methoxyanilino)-2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-5-nitropyrimidine-4-carboxylate.
| Compound Name | ethyl 6-(2-methoxyanilino)-2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-5-nitropyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 86627709 |
| Molecular Formula | C23H30N6O7 |
| Molecular Weight | 502.53 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | ethyl 6-(2-methoxyanilino)-2-[[(3S)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-3-yl]amino]-5-nitropyrimidine-4-carboxylate |
| SMILES | CCOC(=O)c1nc(N[C@H]2CCN(C(=O)OC(C)(C)C)C2)nc(Nc2ccccc2OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C23H30N6O7/c1-6-35-20(30)17-18(29(32)33)19(25-15-9-7-8-10-16(15)34-5)27-21(26-17)24-14-11-12-28(13-14)22(31)36-23(2,3)4/h7-10,14H,6,11-13H2,1-5H3,(H2,24,25,26,27)/t14-/m0/s1 |
| InChIKey | JORNDASGUVZETK-AWEZNQCLSA-N |
| XLogP | 3.73 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|