C22H28N6O7 — CID 67147894
6-(2-methoxyanilino)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methylamino]-5-nitropyrimidine-4-carboxylic acid (PubChem CID 67147894) has the molecular formula C22H28N6O7 and a molecular weight of 488.50 g/mol. Its IUPAC name is 6-(2-methoxyanilino)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methylamino]-5-nitropyrimidine-4-carboxylic acid.
| Compound Name | 6-(2-methoxyanilino)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methylamino]-5-nitropyrimidine-4-carboxylic acid |
|---|---|
| PubChem CID | 67147894 |
| Molecular Formula | C22H28N6O7 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 6-(2-methoxyanilino)-2-[[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]methylamino]-5-nitropyrimidine-4-carboxylic acid |
| SMILES | COc1ccccc1Nc1nc(NCC2CCCN2C(=O)OC(C)(C)C)nc(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N6O7/c1-22(2,3)35-21(31)27-11-7-8-13(27)12-23-20-25-16(19(29)30)17(28(32)33)18(26-20)24-14-9-5-6-10-15(14)34-4/h5-6,9-10,13H,7-8,11-12H2,1-4H3,(H,29,30)(H2,23,24,25,26) |
| InChIKey | BPPGCGKTJMOOFY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|