About [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane
[[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane (PubChem CID 89371159) has the molecular formula C3H7BS6
and a molecular weight of 246.30 g/mol. Its IUPAC name is [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane.
Molecular Properties
| Compound Name | [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane |
| PubChem CID | 89371159 |
| Molecular Formula | C3H7BS6 |
| Molecular Weight | 246.30 g/mol |
| Exact Mass | 245.90 |
| IUPAC Name | [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane |
| SMILES | CCCB=S=S(=S)=S(=S)=S |
| InChI | InChI=1S/C3H7BS6/c1-2-3-4-8-10(7)9(5)6/h2-3H2,1H3 |
| InChIKey | MOVUGILQMALASM-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.30 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane?
The IUPAC name of [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane (CID 89371159) is [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane.
What is the SMILES notation for [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane?
The canonical SMILES for [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane is CCCB=S=S(=S)=S(=S)=S.
What is the InChIKey of [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane?
The InChIKey is MOVUGILQMALASM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7BS6/c1-2-3-4-8-10(7)9(5)6/h2-3H2,1H3.
What are the key properties of [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane?
[[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane has a molecular weight of 246.30 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[[bis(sulfanylidene)-λ6-sulfanylidene]-sulfanylidene-λ6-sulfanylidene]-λ4-sulfanylidene]-propylborane is sourced from PubChem (CID 89371159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).