C12H16N2O2 — CID 89373330
(7,8-dimethyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl) 2-methylpropanoate (PubChem CID 89373330) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is (7,8-dimethyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl) 2-methylpropanoate.
| Compound Name | (7,8-dimethyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 89373330 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | (7,8-dimethyl-7,8-diazabicyclo[4.2.0]octa-1(6),2,4-trien-3-yl) 2-methylpropanoate |
| SMILES | CC(C)C(=O)Oc1ccc2c(c1)n(C)n2C |
| InChI | InChI=1S/C12H16N2O2/c1-8(2)12(15)16-9-5-6-10-11(7-9)14(4)13(10)3/h5-8H,1-4H3 |
| InChIKey | HRGJOQZIGVUCIH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|