C20H23NO6 — CID 89373655
[(1S,4R,6S,13S)-4-hydroxy-9-methoxy-7,16-dioxa-17-azapentacyclo[10.7.1.01,6.08,20.013,17]icosa-2,8,10,12(20)-tetraen-15-yl] acetate (PubChem CID 89373655) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is [(1S,4R,6S,13S)-4-hydroxy-9-methoxy-7,16-dioxa-17-azapentacyclo[10.7.1.01,6.08,20.013,17]icosa-2,8,10,12(20)-tetraen-15-yl] acetate.
| Compound Name | [(1S,4R,6S,13S)-4-hydroxy-9-methoxy-7,16-dioxa-17-azapentacyclo[10.7.1.01,6.08,20.013,17]icosa-2,8,10,12(20)-tetraen-15-yl] acetate |
|---|---|
| PubChem CID | 89373655 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [(1S,4R,6S,13S)-4-hydroxy-9-methoxy-7,16-dioxa-17-azapentacyclo[10.7.1.01,6.08,20.013,17]icosa-2,8,10,12(20)-tetraen-15-yl] acetate |
| SMILES | COc1ccc2c3c1O[C@H]1C[C@@H](O)C=C[C@@]31CCN1OC(OC(C)=O)C[C@@H]21 |
| InChI | InChI=1S/C20H23NO6/c1-11(22)25-17-10-14-13-3-4-15(24-2)19-18(13)20(7-8-21(14)27-17)6-5-12(23)9-16(20)26-19/h3-6,12,14,16-17,23H,7-10H2,1-2H3/t12-,14-,16-,17?,20-/m0/s1 |
| InChIKey | JFAGJWHVTQEXNR-UJVDVDQXSA-N |
| XLogP | 1.99 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|