C22H15IN6 — CID 89376651
5-[2-(iodomethyl)phenyl]-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyridine-4,6-dicarbonitrile (PubChem CID 89376651) has the molecular formula C22H15IN6 and a molecular weight of 490.31 g/mol. Its IUPAC name is 5-[2-(iodomethyl)phenyl]-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyridine-4,6-dicarbonitrile.
| Compound Name | 5-[2-(iodomethyl)phenyl]-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyridine-4,6-dicarbonitrile |
|---|---|
| PubChem CID | 89376651 |
| Molecular Formula | C22H15IN6 |
| Molecular Weight | 490.31 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | 5-[2-(iodomethyl)phenyl]-7-(pyridin-3-ylmethylamino)pyrazolo[1,5-a]pyridine-4,6-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccccc2CI)c(C#N)c2ccnn2c1NCc1cccnc1 |
| InChI | InChI=1S/C22H15IN6/c23-10-16-5-1-2-6-17(16)21-18(11-24)20-7-9-28-29(20)22(19(21)12-25)27-14-15-4-3-8-26-13-15/h1-9,13,27H,10,14H2 |
| InChIKey | WHTTXICTYRZIGA-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.31 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|