C25H30N2O2 — CID 89379555
furan-2-yl-[5-methyl-1'-(3-methylidenecyclohexyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone (PubChem CID 89379555) has the molecular formula C25H30N2O2 and a molecular weight of 390.53 g/mol. Its IUPAC name is furan-2-yl-[5-methyl-1'-(3-methylidenecyclohexyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone.
| Compound Name | furan-2-yl-[5-methyl-1'-(3-methylidenecyclohexyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
|---|---|
| PubChem CID | 89379555 |
| Molecular Formula | C25H30N2O2 |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | furan-2-yl-[5-methyl-1'-(3-methylidenecyclohexyl)spiro[2H-indole-3,4'-piperidine]-1-yl]methanone |
| SMILES | C=C1CCCC(N2CCC3(CC2)CN(C(=O)c2ccco2)c2ccc(C)cc23)C1 |
| InChI | InChI=1S/C25H30N2O2/c1-18-5-3-6-20(15-18)26-12-10-25(11-13-26)17-27(24(28)23-7-4-14-29-23)22-9-8-19(2)16-21(22)25/h4,7-9,14,16,20H,1,3,5-6,10-13,15,17H2,2H3 |
| InChIKey | VLQYYSJIPJVTST-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|