C23H33FN2O — CID 89379517
5-fluoro-1-(2-methoxyethyl)-1'-(3-methylidenecycloheptyl)spiro[2H-indole-3,4'-piperidine] (PubChem CID 89379517) has the molecular formula C23H33FN2O and a molecular weight of 372.53 g/mol. Its IUPAC name is 5-fluoro-1-(2-methoxyethyl)-1'-(3-methylidenecycloheptyl)spiro[2H-indole-3,4'-piperidine].
| Compound Name | 5-fluoro-1-(2-methoxyethyl)-1'-(3-methylidenecycloheptyl)spiro[2H-indole-3,4'-piperidine] |
|---|---|
| PubChem CID | 89379517 |
| Molecular Formula | C23H33FN2O |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 5-fluoro-1-(2-methoxyethyl)-1'-(3-methylidenecycloheptyl)spiro[2H-indole-3,4'-piperidine] |
| SMILES | C=C1CCCCC(N2CCC3(CC2)CN(CCOC)c2ccc(F)cc23)C1 |
| InChI | InChI=1S/C23H33FN2O/c1-18-5-3-4-6-20(15-18)25-11-9-23(10-12-25)17-26(13-14-27-2)22-8-7-19(24)16-21(22)23/h7-8,16,20H,1,3-6,9-15,17H2,2H3 |
| InChIKey | RQVXVPBXPJGSLC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|