C11H26N2O2 — CID 89380830
1,3-dibutoxypropan-2-ylhydrazine (PubChem CID 89380830) has the molecular formula C11H26N2O2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1,3-dibutoxypropan-2-ylhydrazine.
| Compound Name | 1,3-dibutoxypropan-2-ylhydrazine |
|---|---|
| PubChem CID | 89380830 |
| Molecular Formula | C11H26N2O2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | 1,3-dibutoxypropan-2-ylhydrazine |
| SMILES | CCCCOCC(COCCCC)NN |
| InChI | InChI=1S/C11H26N2O2/c1-3-5-7-14-9-11(13-12)10-15-8-6-4-2/h11,13H,3-10,12H2,1-2H3 |
| InChIKey | SDOMZNNOLYTDCR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|