About (cycloheptylideneamino) adamantane-1-carboxylate
(cycloheptylideneamino) adamantane-1-carboxylate (PubChem CID 89381800) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is (cycloheptylideneamino) adamantane-1-carboxylate.
Molecular Properties
| Compound Name | (cycloheptylideneamino) adamantane-1-carboxylate |
| PubChem CID | 89381800 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (cycloheptylideneamino) adamantane-1-carboxylate |
| SMILES | O=C(ON=C1CCCCCC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H27NO2/c20-17(21-19-16-5-3-1-2-4-6-16)18-10-13-7-14(11-18)9-15(8-13)12-18/h13-15H,1-12H2 |
| InChIKey | PUHVIBRQUWPWPR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (cycloheptylideneamino) adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (cycloheptylideneamino) adamantane-1-carboxylate?
The IUPAC name of (cycloheptylideneamino) adamantane-1-carboxylate (CID 89381800) is (cycloheptylideneamino) adamantane-1-carboxylate.
What is the SMILES notation for (cycloheptylideneamino) adamantane-1-carboxylate?
The canonical SMILES for (cycloheptylideneamino) adamantane-1-carboxylate is O=C(ON=C1CCCCCC1)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of (cycloheptylideneamino) adamantane-1-carboxylate?
The InChIKey is PUHVIBRQUWPWPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2/c20-17(21-19-16-5-3-1-2-4-6-16)18-10-13-7-14(11-18)9-15(8-13)12-18/h13-15H,1-12H2.
What are the key properties of (cycloheptylideneamino) adamantane-1-carboxylate?
(cycloheptylideneamino) adamantane-1-carboxylate has a molecular weight of 289.42 g/mol, XLogP of 4.46, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (cycloheptylideneamino) adamantane-1-carboxylate is sourced from PubChem (CID 89381800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).