C20H16ClN9OS — CID 89382518
1-(3-chloro-4-cyanophenyl)-3-[5-[2-(1,2,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-9-yl)ethyl]-1,3-thiazol-2-yl]urea (PubChem CID 89382518) has the molecular formula C20H16ClN9OS and a molecular weight of 465.93 g/mol. Its IUPAC name is 1-(3-chloro-4-cyanophenyl)-3-[5-[2-(1,2,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-9-yl)ethyl]-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(3-chloro-4-cyanophenyl)-3-[5-[2-(1,2,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-9-yl)ethyl]-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 89382518 |
| Molecular Formula | C20H16ClN9OS |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 1-(3-chloro-4-cyanophenyl)-3-[5-[2-(1,2,5,7,9-pentazatricyclo[6.3.1.04,12]dodeca-2,4(12),5,7-tetraen-9-yl)ethyl]-1,3-thiazol-2-yl]urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2ncc(CCN3CCn4ncc5ncnc3c54)s2)cc1Cl |
| InChI | InChI=1S/C20H16ClN9OS/c21-15-7-13(2-1-12(15)8-22)27-19(31)28-20-23-9-14(32-20)3-4-29-5-6-30-17-16(10-26-30)24-11-25-18(17)29/h1-2,7,9-11H,3-6H2,(H2,23,27,28,31) |
| InChIKey | VLVYZVWGFCAARC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |