C28H32BN7O2 — CID 89383843
CID 89383843 (PubChem CID 89383843) has the molecular formula C28H32BN7O2 and a molecular weight of 509.42 g/mol.
| Compound Name | CID 89383843 |
|---|---|
| PubChem CID | 89383843 |
| Molecular Formula | C28H32BN7O2 |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(Nc2ccc(C(=O)N3CCN(C)CC3)cc2)nc1N[C@@H]1CCC[C@@H]1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C28H32BN7O2/c1-35-14-16-36(17-15-35)27(38)19-10-12-21(13-11-19)32-28-30-18-23(29)25(34-28)33-24-9-5-8-22(24)26(37)31-20-6-3-2-4-7-20/h2-4,6-7,10-13,18,22,24H,5,8-9,14-17H2,1H3,(H,31,37)(H2,30,32,33,34)/t22-,24+/m0/s1 |
| InChIKey | LADUJGGSGAXDLC-LADGPHEKSA-N |
| XLogP | 2.62 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|