C19H28N2OS2 — CID 8938468
[2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl] N,N-diethylcarbamodithioate (PubChem CID 8938468) has the molecular formula C19H28N2OS2 and a molecular weight of 364.58 g/mol. Its IUPAC name is [2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl] N,N-diethylcarbamodithioate.
| Compound Name | [2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 8938468 |
| Molecular Formula | C19H28N2OS2 |
| Molecular Weight | 364.58 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | [2-oxo-2-[[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]amino]ethyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)SCC(=O)N[C@@H](C)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H28N2OS2/c1-4-21(5-2)19(23)24-13-18(22)20-14(3)16-11-10-15-8-6-7-9-17(15)12-16/h10-12,14H,4-9,13H2,1-3H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | ZOJGNESABXBXDO-AWEZNQCLSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|