C11H20O3S — CID 89385600
5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid (PubChem CID 89385600) has the molecular formula C11H20O3S and a molecular weight of 232.34 g/mol. Its IUPAC name is 5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid.
| Compound Name | 5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 89385600 |
| Molecular Formula | C11H20O3S |
| Molecular Weight | 232.34 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 5-methyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid |
| SMILES | CC1CCCC2C1CCCC2S(=O)(=O)O |
| InChI | InChI=1S/C11H20O3S/c1-8-4-2-6-10-9(8)5-3-7-11(10)15(12,13)14/h8-11H,2-7H2,1H3,(H,12,13,14) |
| InChIKey | ZSPBXFJIJDZOFC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|