C10H18O6S2 — CID 22762071
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,6-disulfonic acid (PubChem CID 22762071) has the molecular formula C10H18O6S2 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,6-disulfonic acid.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,6-disulfonic acid |
|---|---|
| PubChem CID | 22762071 |
| Molecular Formula | C10H18O6S2 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,6-disulfonic acid |
| SMILES | O=S(=O)(O)C1CCC2C(CCCC2S(=O)(=O)O)C1 |
| InChI | InChI=1S/C10H18O6S2/c11-17(12,13)8-4-5-9-7(6-8)2-1-3-10(9)18(14,15)16/h7-10H,1-6H2,(H,11,12,13)(H,14,15,16) |
| InChIKey | BEAJPWDBYNIURC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|