C12H22O8S3 — CID 89040753
3-(3-sulfocyclohexyl)sulfonylcyclohexane-1-sulfonic acid (PubChem CID 89040753) has the molecular formula C12H22O8S3 and a molecular weight of 390.50 g/mol. Its IUPAC name is 3-(3-sulfocyclohexyl)sulfonylcyclohexane-1-sulfonic acid.
| Compound Name | 3-(3-sulfocyclohexyl)sulfonylcyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 89040753 |
| Molecular Formula | C12H22O8S3 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 3-(3-sulfocyclohexyl)sulfonylcyclohexane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C1CCCC(S(=O)(=O)C2CCCC(S(=O)(=O)O)C2)C1 |
| InChI | InChI=1S/C12H22O8S3/c13-21(14,9-3-1-5-11(7-9)22(15,16)17)10-4-2-6-12(8-10)23(18,19)20/h9-12H,1-8H2,(H,15,16,17)(H,18,19,20) |
| InChIKey | TYNWBQGIKSPQKE-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 142.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|