C6H12O4S — CID 130964743
trans-(1S,3S)-3-hydroxycyclohexane-1-sulfonic acid (PubChem CID 130964743) has the molecular formula C6H12O4S and a molecular weight of 180.22 g/mol. Its IUPAC name is trans-(1S,3S)-3-hydroxycyclohexane-1-sulfonic acid.
| Compound Name | trans-(1S,3S)-3-hydroxycyclohexane-1-sulfonic acid |
|---|---|
| PubChem CID | 130964743 |
| Molecular Formula | C6H12O4S |
| Molecular Weight | 180.22 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | trans-(1S,3S)-3-hydroxycyclohexane-1-sulfonic acid |
| SMILES | O=S(=O)(O)[C@H]1CCC[C@H](O)C1 |
| InChI | InChI=1S/C6H12O4S/c7-5-2-1-3-6(4-5)11(8,9)10/h5-7H,1-4H2,(H,8,9,10)/t5-,6-/m0/s1 |
| InChIKey | YOEBUXVLRTXMEK-WDSKDSINSA-N |
| XLogP | 0.18 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.22 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|