C10H19NO9S3 — CID 57210909
8-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,6-trisulfonic acid (PubChem CID 57210909) has the molecular formula C10H19NO9S3 and a molecular weight of 393.46 g/mol. Its IUPAC name is 8-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,6-trisulfonic acid.
| Compound Name | 8-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,6-trisulfonic acid |
|---|---|
| PubChem CID | 57210909 |
| Molecular Formula | C10H19NO9S3 |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.02 |
| IUPAC Name | 8-amino-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,3,6-trisulfonic acid |
| SMILES | NC1CC(S(=O)(=O)O)CC2CC(S(=O)(=O)O)CC(S(=O)(=O)O)C12 |
| InChI | InChI=1S/C10H19NO9S3/c11-8-3-6(21(12,13)14)1-5-2-7(22(15,16)17)4-9(10(5)8)23(18,19)20/h5-10H,1-4,11H2,(H,12,13,14)(H,15,16,17)(H,18,19,20) |
| InChIKey | AMKBIQLVMDGMLX-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 189.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|