C10H19NO4S — CID 45357317
3-amino-4-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid (PubChem CID 45357317) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is 3-amino-4-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid.
| Compound Name | 3-amino-4-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 45357317 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 3-amino-4-hydroxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-sulfonic acid |
| SMILES | NC1CC(S(=O)(=O)O)C2CCCCC2C1O |
| InChI | InChI=1S/C10H19NO4S/c11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12/h6-10,12H,1-5,11H2,(H,13,14,15) |
| InChIKey | YXCMEZXASDZXGG-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|