C27H41N2O10PS — CID 89390072
[(2S,3R)-1-[4-[[butoxy(hydroxy)phosphoryl]methoxy]phenyl]-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamic acid (PubChem CID 89390072) has the molecular formula C27H41N2O10PS and a molecular weight of 616.67 g/mol. Its IUPAC name is [(2S,3R)-1-[4-[[butoxy(hydroxy)phosphoryl]methoxy]phenyl]-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamic acid.
| Compound Name | [(2S,3R)-1-[4-[[butoxy(hydroxy)phosphoryl]methoxy]phenyl]-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 89390072 |
| Molecular Formula | C27H41N2O10PS |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.22 |
| IUPAC Name | [(2S,3R)-1-[4-[[butoxy(hydroxy)phosphoryl]methoxy]phenyl]-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamic acid |
| SMILES | CCCCOP(=O)(O)COc1ccc(C[C@H](NC(=O)O)[C@H](O)CN(CC(C)C)S(=O)(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C27H41N2O10PS/c1-5-6-15-39-40(33,34)19-38-23-9-7-21(8-10-23)16-25(28-27(31)32)26(30)18-29(17-20(2)3)41(35,36)24-13-11-22(37-4)12-14-24/h7-14,20,25-26,28,30H,5-6,15-19H2,1-4H3,(H,31,32)(H,33,34)/t25-,26+/m0/s1 |
| InChIKey | IBQKARKIBXSFDE-IZZNHLLZSA-N |
| XLogP | 3.92 |
| TPSA | 171.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|