C27H37N3O6S — CID 70310753
butyl N-[(2S,3R)-1-(4-cyanophenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate (PubChem CID 70310753) has the molecular formula C27H37N3O6S and a molecular weight of 531.68 g/mol. Its IUPAC name is butyl N-[(2S,3R)-1-(4-cyanophenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate.
| Compound Name | butyl N-[(2S,3R)-1-(4-cyanophenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 70310753 |
| Molecular Formula | C27H37N3O6S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.24 |
| IUPAC Name | butyl N-[(2S,3R)-1-(4-cyanophenyl)-3-hydroxy-4-[(4-methoxyphenyl)sulfonyl-(2-methylpropyl)amino]butan-2-yl]carbamate |
| SMILES | CCCCOC(=O)N[C@@H](Cc1ccc(C#N)cc1)[C@H](O)CN(CC(C)C)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H37N3O6S/c1-5-6-15-36-27(32)29-25(16-21-7-9-22(17-28)10-8-21)26(31)19-30(18-20(2)3)37(33,34)24-13-11-23(35-4)12-14-24/h7-14,20,25-26,31H,5-6,15-16,18-19H2,1-4H3,(H,29,32)/t25-,26+/m0/s1 |
| InChIKey | ZKENCRLJZCLMDZ-IZZNHLLZSA-N |
| XLogP | 3.71 |
| TPSA | 128.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|