C25H31Cl3N2O — CID 89390511
(4R)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-N-heptyl-2-methyliminopentanamide (PubChem CID 89390511) has the molecular formula C25H31Cl3N2O and a molecular weight of 481.90 g/mol. Its IUPAC name is (4R)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-N-heptyl-2-methyliminopentanamide.
| Compound Name | (4R)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-N-heptyl-2-methyliminopentanamide |
|---|---|
| PubChem CID | 89390511 |
| Molecular Formula | C25H31Cl3N2O |
| Molecular Weight | 481.90 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | (4R)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-N-heptyl-2-methyliminopentanamide |
| SMILES | CCCCCCCNC(=O)/C(C[C@@H](Cc1ccc(Cl)cc1Cl)c1ccc(Cl)cc1)=N\C |
| InChI | InChI=1S/C25H31Cl3N2O/c1-3-4-5-6-7-14-30-25(31)24(29-2)16-20(18-8-11-21(26)12-9-18)15-19-10-13-22(27)17-23(19)28/h8-13,17,20H,3-7,14-16H2,1-2H3,(H,30,31)/b29-24-/t20-/m1/s1 |
| InChIKey | XZWCVESVNYXLRR-LXMSKGSXSA-N |
| XLogP | 7.52 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.90 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|