C18H13F4IN4O3S2 — CID 89392298
N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-(iodomethyl)-4-(1,2,4-thiadiazol-5-ylsulfamoyl)benzamide (PubChem CID 89392298) has the molecular formula C18H13F4IN4O3S2 and a molecular weight of 600.36 g/mol. Its IUPAC name is N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-(iodomethyl)-4-(1,2,4-thiadiazol-5-ylsulfamoyl)benzamide.
| Compound Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-(iodomethyl)-4-(1,2,4-thiadiazol-5-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 89392298 |
| Molecular Formula | C18H13F4IN4O3S2 |
| Molecular Weight | 600.36 g/mol |
| Exact Mass | 599.94 |
| IUPAC Name | N-[[3-fluoro-4-(trifluoromethyl)phenyl]methyl]-2-(iodomethyl)-4-(1,2,4-thiadiazol-5-ylsulfamoyl)benzamide |
| SMILES | O=C(NCc1ccc(C(F)(F)F)c(F)c1)c1ccc(S(=O)(=O)Nc2ncns2)cc1CI |
| InChI | InChI=1S/C18H13F4IN4O3S2/c19-15-5-10(1-4-14(15)18(20,21)22)8-24-16(28)13-3-2-12(6-11(13)7-23)32(29,30)27-17-25-9-26-31-17/h1-6,9H,7-8H2,(H,24,28)(H,25,26,27) |
| InChIKey | MJLNCXCIXVQCEG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|