C9H10O3 — CID 89393505
2-propan-2-ylidenecyclohexane-1,3,5-trione (PubChem CID 89393505) has the molecular formula C9H10O3 and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-propan-2-ylidenecyclohexane-1,3,5-trione.
| Compound Name | 2-propan-2-ylidenecyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 89393505 |
| Molecular Formula | C9H10O3 |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 2-propan-2-ylidenecyclohexane-1,3,5-trione |
| SMILES | CC(C)=C1C(=O)CC(=O)CC1=O |
| InChI | InChI=1S/C9H10O3/c1-5(2)9-7(11)3-6(10)4-8(9)12/h3-4H2,1-2H3 |
| InChIKey | ADTIDYHIFAUDND-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|