C12H17FN2O3S — CID 89397295
N-fluoro-3-(2-methoxyphenyl)piperidine-1-sulfonamide (PubChem CID 89397295) has the molecular formula C12H17FN2O3S and a molecular weight of 288.34 g/mol. Its IUPAC name is N-fluoro-3-(2-methoxyphenyl)piperidine-1-sulfonamide.
| Compound Name | N-fluoro-3-(2-methoxyphenyl)piperidine-1-sulfonamide |
|---|---|
| PubChem CID | 89397295 |
| Molecular Formula | C12H17FN2O3S |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-fluoro-3-(2-methoxyphenyl)piperidine-1-sulfonamide |
| SMILES | COc1ccccc1C1CCCN(S(=O)(=O)NF)C1 |
| InChI | InChI=1S/C12H17FN2O3S/c1-18-12-7-3-2-6-11(12)10-5-4-8-15(9-10)19(16,17)14-13/h2-3,6-7,10,14H,4-5,8-9H2,1H3 |
| InChIKey | RTKKLMUOKGNPOR-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|