C18H29N4O+ — CID 89398872
[4-[3-(4-aminoindol-1-yl)propyl]morpholin-2-yl]-trimethylazanium (PubChem CID 89398872) has the molecular formula C18H29N4O+ and a molecular weight of 317.46 g/mol. Its IUPAC name is [4-[3-(4-aminoindol-1-yl)propyl]morpholin-2-yl]-trimethylazanium.
| Compound Name | [4-[3-(4-aminoindol-1-yl)propyl]morpholin-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 89398872 |
| Molecular Formula | C18H29N4O+ |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | [4-[3-(4-aminoindol-1-yl)propyl]morpholin-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C1CN(CCCn2ccc3c(N)cccc32)CCO1 |
| InChI | InChI=1S/C18H29N4O/c1-22(2,3)18-14-20(12-13-23-18)9-5-10-21-11-8-15-16(19)6-4-7-17(15)21/h4,6-8,11,18H,5,9-10,12-14,19H2,1-3H3/q+1 |
| InChIKey | SDKFYXMFIBGFAB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|