C17H29N3O6S — CID 8939892
tert-butyl 4-[[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 8939892) has the molecular formula C17H29N3O6S and a molecular weight of 403.50 g/mol. Its IUPAC name is tert-butyl 4-[[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 8939892 |
| Molecular Formula | C17H29N3O6S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | tert-butyl 4-[[[2-[(3R)-1,1-dioxothiolan-3-yl]acetyl]amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)C[C@@H]2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C17H29N3O6S/c1-17(2,3)26-16(23)20-7-4-13(5-8-20)15(22)19-18-14(21)10-12-6-9-27(24,25)11-12/h12-13H,4-11H2,1-3H3,(H,18,21)(H,19,22)/t12-/m0/s1 |
| InChIKey | FGTYFQHRBCICAT-LBPRGKRZSA-N |
| XLogP | 0.61 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|