C19H21Cl — CID 89399672
1-chloro-4-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-4-methylhexa-1,3-dien-3-yl]benzene (PubChem CID 89399672) has the molecular formula C19H21Cl and a molecular weight of 284.83 g/mol. Its IUPAC name is 1-chloro-4-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-4-methylhexa-1,3-dien-3-yl]benzene.
| Compound Name | 1-chloro-4-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-4-methylhexa-1,3-dien-3-yl]benzene |
|---|---|
| PubChem CID | 89399672 |
| Molecular Formula | C19H21Cl |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 1-chloro-4-[(1Z,3Z)-1-cyclohexa-1,5-dien-1-yl-4-methylhexa-1,3-dien-3-yl]benzene |
| SMILES | CC/C(C)=C(/C=C\C1=CCCC=C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21Cl/c1-3-15(2)19(17-10-12-18(20)13-11-17)14-9-16-7-5-4-6-8-16/h5,7-14H,3-4,6H2,1-2H3/b14-9-,19-15- |
| InChIKey | ZLQLXPGRWYMUPN-BUXXSPIWSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|