C17H23NO3 — CID 89400444
tert-butyl 7a-ethyl-4-hydroxy-2,7-dihydro-1aH-naphtho[2,3-b]azirine-1-carboxylate (PubChem CID 89400444) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is tert-butyl 7a-ethyl-4-hydroxy-2,7-dihydro-1aH-naphtho[2,3-b]azirine-1-carboxylate.
| Compound Name | tert-butyl 7a-ethyl-4-hydroxy-2,7-dihydro-1aH-naphtho[2,3-b]azirine-1-carboxylate |
|---|---|
| PubChem CID | 89400444 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | tert-butyl 7a-ethyl-4-hydroxy-2,7-dihydro-1aH-naphtho[2,3-b]azirine-1-carboxylate |
| SMILES | CCC12Cc3ccc(O)cc3CC1N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO3/c1-5-17-10-11-6-7-13(19)8-12(11)9-14(17)18(17)15(20)21-16(2,3)4/h6-8,14,19H,5,9-10H2,1-4H3 |
| InChIKey | RNMVIRHGDDARDI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|