About (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide
(2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide (PubChem CID 89402738) has the molecular formula C9H21NO3S
and a molecular weight of 223.34 g/mol. Its IUPAC name is (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide.
Molecular Properties
| Compound Name | (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide |
| PubChem CID | 89402738 |
| Molecular Formula | C9H21NO3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide |
| SMILES | COCCCC[C@H](C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H21NO3S/c1-9(7-5-6-8-13-4)14(11,12)10(2)3/h9H,5-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | SLROYRCYBGZOBV-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide?
The IUPAC name of (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide (CID 89402738) is (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide.
What is the SMILES notation for (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide?
The canonical SMILES for (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide is COCCCC[C@H](C)S(=O)(=O)N(C)C.
What is the InChIKey of (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide?
The InChIKey is SLROYRCYBGZOBV-VIFPVBQESA-N. The full InChI is InChI=1S/C9H21NO3S/c1-9(7-5-6-8-13-4)14(11,12)10(2)3/h9H,5-8H2,1-4H3/t9-/m0/s1.
What are the key properties of (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide?
(2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide has a molecular weight of 223.34 g/mol, XLogP of 1.08, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide is sourced from PubChem (CID 89402738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).