C9H21NO3S — CID 89402738
(2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide (PubChem CID 89402738) has the molecular formula C9H21NO3S and a molecular weight of 223.34 g/mol. Its IUPAC name is (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide.
| Compound Name | (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide |
|---|---|
| PubChem CID | 89402738 |
| Molecular Formula | C9H21NO3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (2S)-6-methoxy-N,N-dimethylhexane-2-sulfonamide |
| SMILES | COCCCC[C@H](C)S(=O)(=O)N(C)C |
| InChI | InChI=1S/C9H21NO3S/c1-9(7-5-6-8-13-4)14(11,12)10(2)3/h9H,5-8H2,1-4H3/t9-/m0/s1 |
| InChIKey | SLROYRCYBGZOBV-VIFPVBQESA-N |
| XLogP | 1.08 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|